C46H69NO13 — CID 101371719
2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide (PubChem CID 101371719) has the molecular formula C46H69NO13 and a molecular weight of 844.05 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide.
| Compound Name | 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
|---|---|
| PubChem CID | 101371719 |
| Molecular Formula | C46H69NO13 |
| Molecular Weight | 844.05 g/mol |
| Exact Mass | 843.48 |
| IUPAC Name | 2-[2-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCC)cc3)c(OCCOCCOCCOCCOCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c2)cc1 |
| InChI | InChI=1S/C46H69NO13/c1-3-5-7-9-21-58-38-16-11-35(12-17-38)37-15-20-40(36-13-18-39(19-14-36)59-22-10-8-6-4-2)43(31-37)60-30-29-56-26-25-54-23-24-55-27-28-57-34-44(51)47-32-41(49)45(52)46(53)42(50)33-48/h11-20,31,41-42,45-46,48-50,52-53H,3-10,21-30,32-34H2,1-2H3,(H,47,51)/t41-,42+,45+,46+/m0/s1 |
| InChIKey | QQPGHCYNEVGFFI-QQEKSHBHSA-N |
| XLogP | 4.94 |
| TPSA | 194.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|