C13H14O9 — CID 59205623
5-(carboxymethoxy)-2-[2-(carboxymethoxy)ethoxy]benzoic acid (PubChem CID 59205623) has the molecular formula C13H14O9 and a molecular weight of 314.25 g/mol. Its IUPAC name is 5-(carboxymethoxy)-2-[2-(carboxymethoxy)ethoxy]benzoic acid.
| Compound Name | 5-(carboxymethoxy)-2-[2-(carboxymethoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 59205623 |
| Molecular Formula | C13H14O9 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-(carboxymethoxy)-2-[2-(carboxymethoxy)ethoxy]benzoic acid |
| SMILES | O=C(O)COCCOc1ccc(OCC(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C13H14O9/c14-11(15)6-20-3-4-21-10-2-1-8(22-7-12(16)17)5-9(10)13(18)19/h1-2,5H,3-4,6-7H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | MGQPAKYGCQDZOX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|