C18H21Br2NO8 — CID 174243652
2-[2-[2-[2-[4-(3,4-dibromo-2-hydroxy-5-oxo-2H-pyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 174243652) has the molecular formula C18H21Br2NO8 and a molecular weight of 539.17 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-(3,4-dibromo-2-hydroxy-5-oxo-2H-pyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-(3,4-dibromo-2-hydroxy-5-oxo-2H-pyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 174243652 |
| Molecular Formula | C18H21Br2NO8 |
| Molecular Weight | 539.17 g/mol |
| Exact Mass | 536.96 |
| IUPAC Name | 2-[2-[2-[2-[4-(3,4-dibromo-2-hydroxy-5-oxo-2H-pyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCOc1ccc(N2C(=O)C(Br)=C(Br)C2O)cc1 |
| InChI | InChI=1S/C18H21Br2NO8/c19-15-16(20)18(25)21(17(15)24)12-1-3-13(4-2-12)29-10-9-27-6-5-26-7-8-28-11-14(22)23/h1-4,17,24H,5-11H2,(H,22,23) |
| InChIKey | OMZUVZKWZHCCBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|