C8H18O4 — CID 71342512
pentane-1,2-diol;propanoic acid (PubChem CID 71342512) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is pentane-1,2-diol;propanoic acid.
| Compound Name | pentane-1,2-diol;propanoic acid |
|---|---|
| PubChem CID | 71342512 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | pentane-1,2-diol;propanoic acid |
| SMILES | CCC(=O)O.CCCC(O)CO |
| InChI | InChI=1S/C5H12O2.C3H6O2/c1-2-3-5(7)4-6;1-2-3(4)5/h5-7H,2-4H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | KWHDMHMGNLCRLC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |