C7H18N2O2 — CID 154140242
4-(3,3-diaminopropoxy)butan-1-ol (PubChem CID 154140242) has the molecular formula C7H18N2O2 and a molecular weight of 162.23 g/mol. Its IUPAC name is 4-(3,3-diaminopropoxy)butan-1-ol.
| Compound Name | 4-(3,3-diaminopropoxy)butan-1-ol |
|---|---|
| PubChem CID | 154140242 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 4-(3,3-diaminopropoxy)butan-1-ol |
| SMILES | NC(N)CCOCCCCO |
| InChI | InChI=1S/C7H18N2O2/c8-7(9)3-6-11-5-2-1-4-10/h7,10H,1-6,8-9H2 |
| InChIKey | OCKWCOBRNFRZMI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|