About 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine
2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine (PubChem CID 158913678) has the molecular formula C29H58Br3NO2
and a molecular weight of 692.50 g/mol. Its IUPAC name is 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine.
Molecular Properties
| Compound Name | 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine |
| PubChem CID | 158913678 |
| Molecular Formula | C29H58Br3NO2 |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine |
| SMILES | CCCCCCCCCCCCCC(=O)CBr.CCCCCCCCCCCCN.O=C(Br)CBr |
| InChI | InChI=1S/C15H29BrO.C12H27N.C2H2Br2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16;1-2-3-4-5-6-7-8-9-10-11-12-13;3-1-2(4)5/h2-14H2,1H3;2-13H2,1H3;1H2 |
| InChIKey | JGYUJDUTXGYHNI-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine?
The IUPAC name of 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine (CID 158913678) is 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine.
What is the SMILES notation for 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine?
The canonical SMILES for 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine is CCCCCCCCCCCCCC(=O)CBr.CCCCCCCCCCCCN.O=C(Br)CBr.
What is the InChIKey of 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine?
The InChIKey is JGYUJDUTXGYHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29BrO.C12H27N.C2H2Br2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16;1-2-3-4-5-6-7-8-9-10-11-12-13;3-1-2(4)5/h2-14H2,1H3;2-13H2,1H3;1H2.
What are the key properties of 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine?
2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine has a molecular weight of 692.50 g/mol, XLogP of 10.82, 24 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoacetyl bromide;1-bromopentadecan-2-one;dodecan-1-amine is sourced from PubChem (CID 158913678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).