About prop-2-enoic acid;undecan-6-one
prop-2-enoic acid;undecan-6-one (PubChem CID 122573755) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is prop-2-enoic acid;undecan-6-one.
Molecular Properties
| Compound Name | prop-2-enoic acid;undecan-6-one |
| PubChem CID | 122573755 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | prop-2-enoic acid;undecan-6-one |
| SMILES | C=CC(=O)O.CCCCCC(=O)CCCCC |
| InChI | InChI=1S/C11H22O.C3H4O2/c1-3-5-7-9-11(12)10-8-6-4-2;1-2-3(4)5/h3-10H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | QMQAFEFAABTXKC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;undecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;undecan-6-one?
The IUPAC name of prop-2-enoic acid;undecan-6-one (CID 122573755) is prop-2-enoic acid;undecan-6-one.
What is the SMILES notation for prop-2-enoic acid;undecan-6-one?
The canonical SMILES for prop-2-enoic acid;undecan-6-one is C=CC(=O)O.CCCCCC(=O)CCCCC.
What is the InChIKey of prop-2-enoic acid;undecan-6-one?
The InChIKey is QMQAFEFAABTXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C3H4O2/c1-3-5-7-9-11(12)10-8-6-4-2;1-2-3(4)5/h3-10H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of prop-2-enoic acid;undecan-6-one?
prop-2-enoic acid;undecan-6-one has a molecular weight of 242.36 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;undecan-6-one is sourced from PubChem (CID 122573755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).