About (E)-tridec-3-ene-2,5-dione
(E)-tridec-3-ene-2,5-dione (PubChem CID 12564114) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (E)-tridec-3-ene-2,5-dione.
Molecular Properties
| Compound Name | (E)-tridec-3-ene-2,5-dione |
| PubChem CID | 12564114 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (E)-tridec-3-ene-2,5-dione |
| SMILES | CCCCCCCCC(=O)/C=C/C(C)=O |
| InChI | InChI=1S/C13H22O2/c1-3-4-5-6-7-8-9-13(15)11-10-12(2)14/h10-11H,3-9H2,1-2H3/b11-10+ |
| InChIKey | DJRNBUDMIMCZAY-ZHACJKMWSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-tridec-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-tridec-3-ene-2,5-dione?
The IUPAC name of (E)-tridec-3-ene-2,5-dione (CID 12564114) is (E)-tridec-3-ene-2,5-dione.
What is the SMILES notation for (E)-tridec-3-ene-2,5-dione?
The canonical SMILES for (E)-tridec-3-ene-2,5-dione is CCCCCCCCC(=O)/C=C/C(C)=O.
What is the InChIKey of (E)-tridec-3-ene-2,5-dione?
The InChIKey is DJRNBUDMIMCZAY-ZHACJKMWSA-N. The full InChI is InChI=1S/C13H22O2/c1-3-4-5-6-7-8-9-13(15)11-10-12(2)14/h10-11H,3-9H2,1-2H3/b11-10+.
What are the key properties of (E)-tridec-3-ene-2,5-dione?
(E)-tridec-3-ene-2,5-dione has a molecular weight of 210.32 g/mol, XLogP of 3.45, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-tridec-3-ene-2,5-dione is sourced from PubChem (CID 12564114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).