C11H15NO — CID 11062951
(2E,4E)-6-oxoundeca-2,4-dienenitrile (PubChem CID 11062951) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2E,4E)-6-oxoundeca-2,4-dienenitrile.
| Compound Name | (2E,4E)-6-oxoundeca-2,4-dienenitrile |
|---|---|
| PubChem CID | 11062951 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2E,4E)-6-oxoundeca-2,4-dienenitrile |
| SMILES | CCCCCC(=O)/C=C/C=C/C#N |
| InChI | InChI=1S/C11H15NO/c1-2-3-5-8-11(13)9-6-4-7-10-12/h4,6-7,9H,2-3,5,8H2,1H3/b7-4+,9-6+ |
| InChIKey | HHHCTTDBLBIIPN-KRHXFINASA-N |
| XLogP | 2.77 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|