About dodec-11-enethioate
dodec-11-enethioate (PubChem CID 22121594) has the molecular formula C12H21OS-
and a molecular weight of 213.37 g/mol. Its IUPAC name is dodec-11-enethioate.
Molecular Properties
| Compound Name | dodec-11-enethioate |
| PubChem CID | 22121594 |
| Molecular Formula | C12H21OS- |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | dodec-11-enethioate |
| SMILES | C=CCCCCCCCCCC(=O)[S-] |
| InChI | InChI=1S/C12H22OS/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2H,1,3-11H2,(H,13,14)/p-1 |
| InChIKey | INXODQOHUKLFCR-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dodec-11-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-11-enethioate?
The IUPAC name of dodec-11-enethioate (CID 22121594) is dodec-11-enethioate.
What is the SMILES notation for dodec-11-enethioate?
The canonical SMILES for dodec-11-enethioate is C=CCCCCCCCCCC(=O)[S-].
What is the InChIKey of dodec-11-enethioate?
The InChIKey is INXODQOHUKLFCR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H22OS/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2H,1,3-11H2,(H,13,14)/p-1.
What are the key properties of dodec-11-enethioate?
dodec-11-enethioate has a molecular weight of 213.37 g/mol, XLogP of 3.76, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-11-enethioate is sourced from PubChem (CID 22121594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).