C28H42O4 — CID 57393198
[(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] benzoate (PubChem CID 57393198) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] benzoate.
| Compound Name | [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] benzoate |
|---|---|
| PubChem CID | 57393198 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] benzoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C[C@@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(29)23-27(30)24-32-28(31)25-20-17-16-18-21-25/h6-7,9-10,16-18,20-21,27,30H,2-5,8,11-15,19,22-24H2,1H3/b7-6-,10-9-/t27-/m1/s1 |
| InChIKey | KWLCXZCGZVVJRD-IQZSKYRKSA-N |
| XLogP | 6.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|