C18H30O3 — CID 129209509
2-[(3Z,6Z,9Z)-pentadeca-3,6,9-trienoxy]propanoic acid (PubChem CID 129209509) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[(3Z,6Z,9Z)-pentadeca-3,6,9-trienoxy]propanoic acid.
| Compound Name | 2-[(3Z,6Z,9Z)-pentadeca-3,6,9-trienoxy]propanoic acid |
|---|---|
| PubChem CID | 129209509 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[(3Z,6Z,9Z)-pentadeca-3,6,9-trienoxy]propanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCOC(C)C(=O)O |
| InChI | InChI=1S/C18H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17(2)18(19)20/h7-8,10-11,13-14,17H,3-6,9,12,15-16H2,1-2H3,(H,19,20)/b8-7-,11-10-,14-13- |
| InChIKey | RQMSNYONVUSUHW-JPFHKJGASA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|