C38H74N4O5 — CID 167145453
7-[[(3Z)-3-amino-3-hydrazinylidenepropyl]-(7-methoxyheptyl)amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate (PubChem CID 167145453) has the molecular formula C38H74N4O5 and a molecular weight of 667.03 g/mol. Its IUPAC name is 7-[[(3Z)-3-amino-3-hydrazinylidenepropyl]-(7-methoxyheptyl)amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate.
| Compound Name | 7-[[(3Z)-3-amino-3-hydrazinylidenepropyl]-(7-methoxyheptyl)amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
|---|---|
| PubChem CID | 167145453 |
| Molecular Formula | C38H74N4O5 |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 666.57 |
| IUPAC Name | 7-[[(3Z)-3-amino-3-hydrazinylidenepropyl]-(7-methoxyheptyl)amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCCN(CCCCCCCOC)CC/C(N)=N/N)OCCCC/C=C\CC |
| InChI | InChI=1S/C38H74N4O5/c1-4-6-8-10-17-24-34-46-38(47-35-25-18-11-9-7-5-2)27-26-37(43)45-33-23-19-13-15-21-30-42(31-28-36(39)41-40)29-20-14-12-16-22-32-44-3/h6-9,38H,4-5,10-35,40H2,1-3H3,(H2,39,41)/b8-6-,9-7- |
| InChIKey | ZNJBJGZGSBPLJM-VRHVFUOLSA-N |
| XLogP | 8.41 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|