C60H110N2O9S — CID 164552220
7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(dimethylamino)propylsulfanylcarbonyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate (PubChem CID 164552220) has the molecular formula C60H110N2O9S and a molecular weight of 1035.61 g/mol. Its IUPAC name is 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(dimethylamino)propylsulfanylcarbonyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate.
| Compound Name | 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(dimethylamino)propylsulfanylcarbonyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
|---|---|
| PubChem CID | 164552220 |
| Molecular Formula | C60H110N2O9S |
| Molecular Weight | 1035.61 g/mol |
| Exact Mass | 1034.79 |
| IUPAC Name | 7-[7-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]heptyl-[3-(dimethylamino)propylsulfanylcarbonyl]amino]heptyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCCN(CCCCCCCOC(=O)CCC(OCCCC/C=C\CC)OCCCC/C=C\CC)C(=O)SCCCN(C)C)OCCCC/C=C\CC |
| InChI | InChI=1S/C60H110N2O9S/c1-7-11-15-19-27-37-51-68-58(69-52-38-28-20-16-12-8-2)44-42-56(63)66-49-35-31-23-25-33-47-62(60(65)72-55-41-46-61(5)6)48-34-26-24-32-36-50-67-57(64)43-45-59(70-53-39-29-21-17-13-9-3)71-54-40-30-22-18-14-10-4/h11-18,58-59H,7-10,19-55H2,1-6H3/b15-11-,16-12-,17-13-,18-14- |
| InChIKey | IOAABIBLHCCFNO-UDWYOESYSA-N |
| XLogP | 15.91 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.61 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|