C30H53NO5 — CID 146280108
[2-(methoxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-methylpiperidine-3-carboxylate (PubChem CID 146280108) has the molecular formula C30H53NO5 and a molecular weight of 507.76 g/mol. Its IUPAC name is [2-(methoxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-methylpiperidine-3-carboxylate.
| Compound Name | [2-(methoxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-methylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 146280108 |
| Molecular Formula | C30H53NO5 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.39 |
| IUPAC Name | [2-(methoxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-methylpiperidine-3-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC)COC(=O)C1CCCN(C)C1 |
| InChI | InChI=1S/C30H53NO5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29(32)35-25-27(24-34-3)26-36-30(33)28-20-19-22-31(2)23-28/h8-9,11-12,27-28H,4-7,10,13-26H2,1-3H3/b9-8-,12-11- |
| InChIKey | HIYATRNFIRZJDS-MURFETPASA-N |
| XLogP | 6.49 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|