C46H80N4O4 — CID 176968835
[2-[[N'-(1-ethylazetidin-3-yl)carbamimidoyl]oxymethyl]-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienimidoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 176968835) has the molecular formula C46H80N4O4 and a molecular weight of 753.17 g/mol. Its IUPAC name is [2-[[N'-(1-ethylazetidin-3-yl)carbamimidoyl]oxymethyl]-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienimidoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[[N'-(1-ethylazetidin-3-yl)carbamimidoyl]oxymethyl]-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienimidoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 176968835 |
| Molecular Formula | C46H80N4O4 |
| Molecular Weight | 753.17 g/mol |
| Exact Mass | 752.62 |
| IUPAC Name | [2-[[N'-(1-ethylazetidin-3-yl)carbamimidoyl]oxymethyl]-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienimidoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | [H]/N=C(\CCCCCCC/C=C\C/C=C\C/C=C\CC)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CO/C(N)=N/C1CN(CC)C1 |
| InChI | InChI=1S/C46H80N4O4/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-44(47)52-39-42(41-54-46(48)49-43-37-50(6-3)38-43)40-53-45(51)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h7,9,13-16,19-22,42-43,47H,4-6,8,10-12,17-18,23-41H2,1-3H3,(H2,48,49)/b9-7-,15-13-,16-14-,21-19-,22-20-,47-44+ |
| InChIKey | LVWNSLYSIPWVOU-XPHYWVHJSA-N |
| XLogP | 11.58 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.17 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|