C56H99NO9 — CID 159628800
[2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-(4-piperidin-1-ylbutoxycarbonyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 159628800) has the molecular formula C56H99NO9 and a molecular weight of 930.41 g/mol. Its IUPAC name is [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-(4-piperidin-1-ylbutoxycarbonyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-(4-piperidin-1-ylbutoxycarbonyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 159628800 |
| Molecular Formula | C56H99NO9 |
| Molecular Weight | 930.41 g/mol |
| Exact Mass | 929.73 |
| IUPAC Name | [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-(4-piperidin-1-ylbutoxycarbonyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCC(C)CCC=C(C)C)OCCC(C)CCC=C(C)C)COC(=O)OCCCCN1CCCCC1 |
| InChI | InChI=1S/C56H99NO9/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-34-53(58)64-45-52(47-66-56(60)63-42-27-26-41-57-39-24-22-25-40-57)46-65-54(59)35-36-55(61-43-37-50(6)32-28-30-48(2)3)62-44-38-51(7)33-29-31-49(4)5/h12-13,15-16,30-31,50-52,55H,8-11,14,17-29,32-47H2,1-7H3/b13-12-,16-15- |
| InChIKey | TVFSSSSOGKSGGY-QGLGPCELSA-N |
| XLogP | 14.61 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.41 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|