C57H94N2O8 — CID 166063150
[2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-pyridin-4-ylpiperidine-4-carboxylate (PubChem CID 166063150) has the molecular formula C57H94N2O8 and a molecular weight of 935.38 g/mol. Its IUPAC name is [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-pyridin-4-ylpiperidine-4-carboxylate.
| Compound Name | [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-pyridin-4-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166063150 |
| Molecular Formula | C57H94N2O8 |
| Molecular Weight | 935.38 g/mol |
| Exact Mass | 934.70 |
| IUPAC Name | [2-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-pyridin-4-ylpiperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCC(C)CCC=C(C)C)OCCC(C)CCC=C(C)C)COC(=O)C1CCNC(c2ccncc2)C1 |
| InChI | InChI=1S/C57H94N2O8/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29-54(60)65-43-50(45-67-57(62)52-34-39-59-53(42-52)51-32-37-58-38-33-51)44-66-55(61)30-31-56(63-40-35-48(6)27-23-25-46(2)3)64-41-36-49(7)28-24-26-47(4)5/h12-13,15-16,25-26,32-33,37-38,48-50,52-53,56,59H,8-11,14,17-24,27-31,34-36,39-45H2,1-7H3/b13-12-,16-15- |
| InChIKey | KRQCRJZJVQQETO-QGLGPCELSA-N |
| XLogP | 13.87 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.38 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|