C40H56F18O7 — CID 159180419
[2-[4,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)butanoyloxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 159180419) has the molecular formula C40H56F18O7 and a molecular weight of 990.84 g/mol. Its IUPAC name is [2-[4,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)butanoyloxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)butanoyloxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 159180419 |
| Molecular Formula | C40H56F18O7 |
| Molecular Weight | 990.84 g/mol |
| Exact Mass | 990.37 |
| IUPAC Name | [2-[4,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)butanoyloxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO)COC(=O)CCC(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C40H56F18O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-30(60)64-27-29(26-59)28-65-31(61)20-21-32(62-24-17-22-33(41,42)35(45,46)37(49,50)39(53,54)55)63-25-18-23-34(43,44)36(47,48)38(51,52)40(56,57)58/h6-7,9-10,29,32,59H,2-5,8,11-28H2,1H3/b7-6-,10-9- |
| InChIKey | KMUVTRLXKRKXSI-HZJYTTRNSA-N |
| XLogP | 13.13 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.84 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|