C41H74O5 — CID 176810804
[2-(hydroxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 3-octylundec-2-enoate (PubChem CID 176810804) has the molecular formula C41H74O5 and a molecular weight of 647.04 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 3-octylundec-2-enoate.
| Compound Name | [2-(hydroxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 3-octylundec-2-enoate |
|---|---|
| PubChem CID | 176810804 |
| Molecular Formula | C41H74O5 |
| Molecular Weight | 647.04 g/mol |
| Exact Mass | 646.55 |
| IUPAC Name | [2-(hydroxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 3-octylundec-2-enoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO)COC(=O)C=C(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C41H74O5/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-27-30-33-40(43)45-36-39(35-42)37-46-41(44)34-38(31-28-25-14-11-8-5-2)32-29-26-15-12-9-6-3/h16-17,19-20,34,39,42H,4-15,18,21-33,35-37H2,1-3H3/b17-16-,20-19- |
| InChIKey | NLAPWTMAGDQTGS-LTXDKZCQSA-N |
| XLogP | 11.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.04 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|