C34H60O5 — CID 176810850
[2-[[(Z)-3-butyloct-2-enoyl]oxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 176810850) has the molecular formula C34H60O5 and a molecular weight of 548.85 g/mol. Its IUPAC name is [2-[[(Z)-3-butyloct-2-enoyl]oxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[[(Z)-3-butyloct-2-enoyl]oxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 176810850 |
| Molecular Formula | C34H60O5 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | [2-[[(Z)-3-butyloct-2-enoyl]oxymethyl]-3-hydroxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO)COC(=O)/C=C(/CCCC)CCCCC |
| InChI | InChI=1S/C34H60O5/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-21-23-26-33(36)38-29-32(28-35)30-39-34(37)27-31(24-9-6-3)25-22-8-5-2/h12-13,15-16,27,32,35H,4-11,14,17-26,28-30H2,1-3H3/b13-12-,16-15-,31-27- |
| InChIKey | NOYKZKMDZQAZTC-YYHZPKMNSA-N |
| XLogP | 9.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|