C52H86N2O8 — CID 158300497
[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[3-(2-pyridin-4-ylethylamino)propanoyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 158300497) has the molecular formula C52H86N2O8 and a molecular weight of 867.27 g/mol. Its IUPAC name is [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[3-(2-pyridin-4-ylethylamino)propanoyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[3-(2-pyridin-4-ylethylamino)propanoyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 158300497 |
| Molecular Formula | C52H86N2O8 |
| Molecular Weight | 867.27 g/mol |
| Exact Mass | 866.64 |
| IUPAC Name | [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[3-(2-pyridin-4-ylethylamino)propanoyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)CCNCCc1ccncc1)OCCCC/C=C\CC |
| InChI | InChI=1S/C52H86N2O8/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-31-49(55)60-44-48(46-62-51(57)37-41-54-40-36-47-34-38-53-39-35-47)45-61-50(56)32-33-52(58-42-29-26-14-11-8-5-2)59-43-30-27-15-12-9-6-3/h8-9,11-12,16-17,19-20,34-35,38-39,48,52,54H,4-7,10,13-15,18,21-33,36-37,40-46H2,1-3H3/b11-8-,12-9-,17-16-,20-19- |
| InChIKey | YPCPITIFQAMOAR-QBXBLZHRSA-N |
| XLogP | 12.08 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.27 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|