C58H104N2O12 — CID 170736393
[7-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)octanoyloxy]propoxy]-7-oxoheptyl] 2-butyloctanoate (PubChem CID 170736393) has the molecular formula C58H104N2O12 and a molecular weight of 1021.47 g/mol. Its IUPAC name is [7-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)octanoyloxy]propoxy]-7-oxoheptyl] 2-butyloctanoate.
| Compound Name | [7-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)octanoyloxy]propoxy]-7-oxoheptyl] 2-butyloctanoate |
|---|---|
| PubChem CID | 170736393 |
| Molecular Formula | C58H104N2O12 |
| Molecular Weight | 1021.47 g/mol |
| Exact Mass | 1020.76 |
| IUPAC Name | [7-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)octanoyloxy]propoxy]-7-oxoheptyl] 2-butyloctanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCCCOC(=O)C(CCCC)CCCCCC)COC(=O)CCC(CCCC)OC(=O)NCCN1CCCC1)OCCCC/C=C\CC |
| InChI | InChI=1S/C58H104N2O12/c1-6-11-16-19-22-29-44-66-56(67-45-30-23-20-17-12-7-2)39-38-55(63)71-49-50(48-70-54(62)37-36-52(34-15-10-5)72-58(65)59-40-43-60-41-27-28-42-60)47-69-53(61)35-26-21-24-31-46-68-57(64)51(32-14-9-4)33-25-18-13-8-3/h11-12,16-17,50-52,56H,6-10,13-15,18-49H2,1-5H3,(H,59,65)/b16-11-,17-12- |
| InChIKey | AZRZTAFLXPXUDY-LSQIQBGYSA-N |
| XLogP | 13.08 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.47 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|