C64H110N2O10 — CID 164591066
[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 164591066) has the molecular formula C64H110N2O10 and a molecular weight of 1067.59 g/mol. Its IUPAC name is [3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 164591066 |
| Molecular Formula | C64H110N2O10 |
| Molecular Weight | 1067.59 g/mol |
| Exact Mass | 1066.82 |
| IUPAC Name | [3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCc1cc(COC(=O)CCC(CCCCCC)OC(=O)NCCN2CCCC2)cc(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)c1 |
| InChI | InChI=1S/C64H110N2O10/c1-5-9-13-17-20-21-22-23-24-25-26-27-28-29-33-39-60(67)73-53-56-50-57(54-74-61(68)41-40-59(38-32-16-12-8-4)76-64(70)65-44-47-66-45-34-35-46-66)52-58(51-56)55-75-62(69)42-43-63(71-48-36-30-18-14-10-6-2)72-49-37-31-19-15-11-7-3/h20-21,23-24,50-52,59,63H,5-19,22,25-49,53-55H2,1-4H3,(H,65,70)/b21-20-,24-23- |
| InChIKey | QPVXIPIBZYJREM-IFLFXUNCSA-N |
| XLogP | 16.43 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.59 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|