C56H91NO9 — CID 164591334
[3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 164591334) has the molecular formula C56H91NO9 and a molecular weight of 922.34 g/mol. Its IUPAC name is [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 164591334 |
| Molecular Formula | C56H91NO9 |
| Molecular Weight | 922.34 g/mol |
| Exact Mass | 921.67 |
| IUPAC Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCc1cc(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)cc(COC(=O)OCC2CCCN(CC)C2)c1)OCCCC/C=C\CC |
| InChI | InChI=1S/C56H91NO9/c1-5-9-12-15-18-19-20-21-22-23-24-25-26-27-30-35-53(58)63-46-50-41-51(43-52(42-50)48-66-56(60)65-45-49-34-33-38-57(8-4)44-49)47-64-54(59)36-37-55(61-39-31-28-16-13-10-6-2)62-40-32-29-17-14-11-7-3/h10-11,13-14,18-19,21-22,41-43,49,55H,5-9,12,15-17,20,23-40,44-48H2,1-4H3/b13-10-,14-11-,19-18-,22-21- |
| InChIKey | UHOBBDVRDXCCLA-ZSDQLALFSA-N |
| XLogP | 14.38 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.34 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|