C57H93NO11 — CID 164591364
[3-[4,4-bis[(Z)-oct-3-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl 4-[(Z)-hept-3-enoxy]-4-[(Z)-oct-3-enoxy]butanoate (PubChem CID 164591364) has the molecular formula C57H93NO11 and a molecular weight of 968.37 g/mol. Its IUPAC name is [3-[4,4-bis[(Z)-oct-3-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl 4-[(Z)-hept-3-enoxy]-4-[(Z)-oct-3-enoxy]butanoate.
| Compound Name | [3-[4,4-bis[(Z)-oct-3-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl 4-[(Z)-hept-3-enoxy]-4-[(Z)-oct-3-enoxy]butanoate |
|---|---|
| PubChem CID | 164591364 |
| Molecular Formula | C57H93NO11 |
| Molecular Weight | 968.37 g/mol |
| Exact Mass | 967.67 |
| IUPAC Name | [3-[4,4-bis[(Z)-oct-3-enoxy]butanoyloxymethyl]-5-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]phenyl]methyl 4-[(Z)-hept-3-enoxy]-4-[(Z)-oct-3-enoxy]butanoate |
| SMILES | CCC/C=C\CCOC(CCC(=O)OCc1cc(COC(=O)CCC(OCC/C=C\CCCC)OCC/C=C\CCCC)cc(COC(=O)OCC2CCCN(CC)C2)c1)OCC/C=C\CCCC |
| InChI | InChI=1S/C57H93NO11/c1-6-11-15-19-23-27-38-63-55(62-37-26-22-18-14-9-4)34-32-53(59)66-46-50-41-51(43-52(42-50)48-69-57(61)68-45-49-31-30-36-58(10-5)44-49)47-67-54(60)33-35-56(64-39-28-24-20-16-12-7-2)65-40-29-25-21-17-13-8-3/h18-25,41-43,49,55-56H,6-17,26-40,44-48H2,1-5H3/b22-18-,23-19-,24-20-,25-21- |
| InChIKey | FEKXEYTVNRLBGL-DZKLMYQDSA-N |
| XLogP | 13.59 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.37 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|