C47H81NO11 — CID 164591251
6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-oct-3-enyl] hexanedioate (PubChem CID 164591251) has the molecular formula C47H81NO11 and a molecular weight of 836.16 g/mol. Its IUPAC name is 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-oct-3-enyl] hexanedioate.
| Compound Name | 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-oct-3-enyl] hexanedioate |
|---|---|
| PubChem CID | 164591251 |
| Molecular Formula | C47H81NO11 |
| Molecular Weight | 836.16 g/mol |
| Exact Mass | 835.58 |
| IUPAC Name | 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-oct-3-enyl] hexanedioate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCC(=O)OCC/C=C\CCCC)COC(=O)OCC1CCCN(CC)C1)OCCCC/C=C\CC |
| InChI | InChI=1S/C47H81NO11/c1-5-9-12-15-18-23-33-53-43(49)28-21-22-29-44(50)56-38-42(40-59-47(52)58-37-41-27-26-32-48(8-4)36-41)39-57-45(51)30-31-46(54-34-24-19-16-13-10-6-2)55-35-25-20-17-14-11-7-3/h10-11,13-15,18,41-42,46H,5-9,12,16-17,19-40H2,1-4H3/b13-10-,14-11-,18-15- |
| InChIKey | IJVAOJKPHLFKRD-BLPARALSSA-N |
| XLogP | 10.23 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.16 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|