C61H109NO11 — CID 164591259
[2-[6,6-bis[(E)-non-2-enoxy]hexanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 6,6-bis[(E)-non-2-enoxy]hexanoate (PubChem CID 164591259) has the molecular formula C61H109NO11 and a molecular weight of 1032.54 g/mol. Its IUPAC name is [2-[6,6-bis[(E)-non-2-enoxy]hexanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 6,6-bis[(E)-non-2-enoxy]hexanoate.
| Compound Name | [2-[6,6-bis[(E)-non-2-enoxy]hexanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 6,6-bis[(E)-non-2-enoxy]hexanoate |
|---|---|
| PubChem CID | 164591259 |
| Molecular Formula | C61H109NO11 |
| Molecular Weight | 1032.54 g/mol |
| Exact Mass | 1031.80 |
| IUPAC Name | [2-[6,6-bis[(E)-non-2-enoxy]hexanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 6,6-bis[(E)-non-2-enoxy]hexanoate |
| SMILES | CCCCCC/C=C/COC(CCCCC(=O)OCC(COC(=O)CCCCC(OC/C=C/CCCCCC)OC/C=C/CCCCCC)COC(=O)OCC1CCCN(CC)C1)OC/C=C/CCCCCC |
| InChI | InChI=1S/C61H109NO11/c1-6-11-15-19-23-27-35-46-66-59(67-47-36-28-24-20-16-12-7-2)43-33-31-41-57(63)70-52-56(54-73-61(65)72-51-55-40-39-45-62(10-5)50-55)53-71-58(64)42-32-34-44-60(68-48-37-29-25-21-17-13-8-3)69-49-38-30-26-22-18-14-9-4/h27-30,35-38,55-56,59-60H,6-26,31-34,39-54H2,1-5H3/b35-27+,36-28+,37-29+,38-30+ |
| InChIKey | SKRMVZRXGJCCJN-ZALAWZGLSA-N |
| XLogP | 15.52 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.54 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|