C53H95NO11 — CID 167540655
7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-(3-butylnonyl) heptanedioate (PubChem CID 167540655) has the molecular formula C53H95NO11 and a molecular weight of 922.34 g/mol. Its IUPAC name is 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-(3-butylnonyl) heptanedioate.
| Compound Name | 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-(3-butylnonyl) heptanedioate |
|---|---|
| PubChem CID | 167540655 |
| Molecular Formula | C53H95NO11 |
| Molecular Weight | 922.34 g/mol |
| Exact Mass | 921.69 |
| IUPAC Name | 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-(3-butylnonyl) heptanedioate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCCC(=O)OCCC(CCCC)CCCCCC)COC(=O)OCC1CCCN(CC)C1)OCCCC/C=C\CC |
| InChI | InChI=1S/C53H95NO11/c1-6-11-15-18-20-26-38-60-52(61-39-27-21-19-16-12-7-2)35-34-51(57)63-44-48(45-65-53(58)64-42-47-31-28-37-54(10-5)41-47)43-62-50(56)33-25-22-24-32-49(55)59-40-36-46(29-14-9-4)30-23-17-13-8-3/h11-12,15-16,46-48,52H,6-10,13-14,17-45H2,1-5H3/b15-11-,16-12- |
| InChIKey | BDLJKISARMRLSQ-NFLUSIDLSA-N |
| XLogP | 12.65 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.34 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|