C52H95NO11 — CID 164591221
6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(E)-non-2-enyl] hexanedioate;ethane (PubChem CID 164591221) has the molecular formula C52H95NO11 and a molecular weight of 910.33 g/mol. Its IUPAC name is 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(E)-non-2-enyl] hexanedioate;ethane.
| Compound Name | 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(E)-non-2-enyl] hexanedioate;ethane |
|---|---|
| PubChem CID | 164591221 |
| Molecular Formula | C52H95NO11 |
| Molecular Weight | 910.33 g/mol |
| Exact Mass | 909.69 |
| IUPAC Name | 6-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(E)-non-2-enyl] hexanedioate;ethane |
| SMILES | CC.CC.CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCC(=O)OC/C=C/CCCCCC)COC(=O)OCC1CCCN(CC)C1)OCCCC/C=C\CC |
| InChI | InChI=1S/C48H83NO11.2C2H6/c1-5-9-12-15-18-21-24-34-54-44(50)29-22-23-30-45(51)57-39-43(41-60-48(53)59-38-42-28-27-33-49(8-4)37-42)40-58-46(52)31-32-47(55-35-25-19-16-13-10-6-2)56-36-26-20-17-14-11-7-3;2*1-2/h10-11,13-14,21,24,42-43,47H,5-9,12,15-20,22-23,25-41H2,1-4H3;2*1-2H3/b13-10-,14-11-,24-21+;; |
| InChIKey | TZIPIRDNKMPKFJ-DOAZQENGSA-N |
| XLogP | 12.67 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.33 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|