C51H89NO11 — CID 164591170
8-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-dec-4-enyl] octanedioate (PubChem CID 164591170) has the molecular formula C51H89NO11 and a molecular weight of 892.27 g/mol. Its IUPAC name is 8-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-dec-4-enyl] octanedioate.
| Compound Name | 8-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-dec-4-enyl] octanedioate |
|---|---|
| PubChem CID | 164591170 |
| Molecular Formula | C51H89NO11 |
| Molecular Weight | 892.27 g/mol |
| Exact Mass | 891.64 |
| IUPAC Name | 8-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxy]propyl] 1-O-[(Z)-dec-4-enyl] octanedioate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCCCC(=O)OCCC/C=C\CCCCC)COC(=O)OCC1CCCN(CC)C1)OCCCC/C=C\CC |
| InChI | InChI=1S/C51H89NO11/c1-5-9-12-15-18-19-24-27-37-57-47(53)32-25-20-21-26-33-48(54)60-42-46(44-63-51(56)62-41-45-31-30-36-52(8-4)40-45)43-61-49(55)34-35-50(58-38-28-22-16-13-10-6-2)59-39-29-23-17-14-11-7-3/h10-11,13-14,18-19,45-46,50H,5-9,12,15-17,20-44H2,1-4H3/b13-10-,14-11-,19-18- |
| InChIKey | RWTJVSWOLGRVQM-FWSOCNGGSA-N |
| XLogP | 11.79 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.27 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|