C34H57NO6 — CID 174145860
[3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyloctoxy)acetate (PubChem CID 174145860) has the molecular formula C34H57NO6 and a molecular weight of 575.83 g/mol. Its IUPAC name is [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyloctoxy)acetate.
| Compound Name | [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyloctoxy)acetate |
|---|---|
| PubChem CID | 174145860 |
| Molecular Formula | C34H57NO6 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.42 |
| IUPAC Name | [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyloctoxy)acetate |
| SMILES | CCCCCCC(CCCCCC)COCC(=O)OCc1cc(C)cc(COC(=O)OCC2CCCN(CC)C2)c1 |
| InChI | InChI=1S/C34H57NO6/c1-5-8-10-12-15-29(16-13-11-9-6-2)23-38-27-33(36)39-25-31-19-28(4)20-32(21-31)26-41-34(37)40-24-30-17-14-18-35(7-3)22-30/h19-21,29-30H,5-18,22-27H2,1-4H3 |
| InChIKey | YKCKGTYYGCBAAZ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|