C36H61NO6 — CID 174145850
[3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyldecoxy)acetate (PubChem CID 174145850) has the molecular formula C36H61NO6 and a molecular weight of 603.89 g/mol. Its IUPAC name is [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyldecoxy)acetate.
| Compound Name | [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyldecoxy)acetate |
|---|---|
| PubChem CID | 174145850 |
| Molecular Formula | C36H61NO6 |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 603.45 |
| IUPAC Name | [3-[(1-ethylpiperidin-3-yl)methoxycarbonyloxymethyl]-5-methylphenyl]methyl 2-(2-hexyldecoxy)acetate |
| SMILES | CCCCCCCCC(CCCCCC)COCC(=O)OCc1cc(C)cc(COC(=O)OCC2CCCN(CC)C2)c1 |
| InChI | InChI=1S/C36H61NO6/c1-5-8-10-12-13-15-18-31(17-14-11-9-6-2)25-40-29-35(38)41-27-33-21-30(4)22-34(23-33)28-43-36(39)42-26-32-19-16-20-37(7-3)24-32/h21-23,31-32H,5-20,24-29H2,1-4H3 |
| InChIKey | ISVLEMGNHGFHDY-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|