C56H110N4O4 — CID 159125317
2-[2-(diethylamino)ethyl-methylamino]ethanol;2-[2-(diethylamino)ethyl-methylamino]ethyl [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] carbonate (PubChem CID 159125317) has the molecular formula C56H110N4O4 and a molecular weight of 903.52 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl-methylamino]ethanol;2-[2-(diethylamino)ethyl-methylamino]ethyl [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] carbonate.
| Compound Name | 2-[2-(diethylamino)ethyl-methylamino]ethanol;2-[2-(diethylamino)ethyl-methylamino]ethyl [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] carbonate |
|---|---|
| PubChem CID | 159125317 |
| Molecular Formula | C56H110N4O4 |
| Molecular Weight | 903.52 g/mol |
| Exact Mass | 902.85 |
| IUPAC Name | 2-[2-(diethylamino)ethyl-methylamino]ethanol;2-[2-(diethylamino)ethyl-methylamino]ethyl [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)OCCN(C)CCN(CC)CC.CCN(CC)CCN(C)CCO |
| InChI | InChI=1S/C47H88N2O3.C9H22N2O/c1-6-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-46(52-47(50)51-45-44-48(5)42-43-49(8-3)9-4)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-7-2;1-4-11(5-2)7-6-10(3)8-9-12/h16-19,22-25,46H,6-15,20-21,26-45H2,1-5H3;12H,4-9H2,1-3H3/b18-16-,19-17-,24-22-,25-23-; |
| InChIKey | KGEWPALXKSUJPA-DNWGZANHSA-N |
| XLogP | 14.44 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.52 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|