C48H91NO9 — CID 171567033
[2-[3-(ethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] 4,4-dioctoxybutanoate (PubChem CID 171567033) has the molecular formula C48H91NO9 and a molecular weight of 826.25 g/mol. Its IUPAC name is [2-[3-(ethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] 4,4-dioctoxybutanoate.
| Compound Name | [2-[3-(ethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] 4,4-dioctoxybutanoate |
|---|---|
| PubChem CID | 171567033 |
| Molecular Formula | C48H91NO9 |
| Molecular Weight | 826.25 g/mol |
| Exact Mass | 825.67 |
| IUPAC Name | [2-[3-(ethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] 4,4-dioctoxybutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)OCCCNCC |
| InChI | InChI=1S/C48H91NO9/c1-5-9-12-15-18-19-20-21-22-23-24-25-26-27-30-34-45(50)56-41-44(43-58-48(52)55-40-33-37-49-8-4)42-57-46(51)35-36-47(53-38-31-28-16-13-10-6-2)54-39-32-29-17-14-11-7-3/h18-19,21-22,44-45,47,49-50H,5-17,20,23-43H2,1-4H3/b19-18-,22-21- |
| InChIKey | ADPYDECAGIJLBK-VYEFPUSRSA-N |
| XLogP | 12.31 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.25 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|