C46H89NO7 — CID 118168848
[3-[3-(dimethylamino)propoxycarbonyloxy]-13-octanoyloxytridecyl] 3-octylundecanoate (PubChem CID 118168848) has the molecular formula C46H89NO7 and a molecular weight of 768.22 g/mol. Its IUPAC name is [3-[3-(dimethylamino)propoxycarbonyloxy]-13-octanoyloxytridecyl] 3-octylundecanoate.
| Compound Name | [3-[3-(dimethylamino)propoxycarbonyloxy]-13-octanoyloxytridecyl] 3-octylundecanoate |
|---|---|
| PubChem CID | 118168848 |
| Molecular Formula | C46H89NO7 |
| Molecular Weight | 768.22 g/mol |
| Exact Mass | 767.66 |
| IUPAC Name | [3-[3-(dimethylamino)propoxycarbonyloxy]-13-octanoyloxytridecyl] 3-octylundecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)OCCC(CCCCCCCCCCOC(=O)CCCCCCC)OC(=O)OCCCN(C)C |
| InChI | InChI=1S/C46H89NO7/c1-6-9-12-15-22-26-32-42(33-27-23-16-13-10-7-2)41-45(49)52-40-36-43(54-46(50)53-39-31-37-47(4)5)34-28-24-19-17-18-20-25-30-38-51-44(48)35-29-21-14-11-8-3/h42-43H,6-41H2,1-5H3 |
| InChIKey | JZMUDPGZRWUKIF-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.22 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|