C38H75NO6 — CID 118168932
[3-[3-(dimethylamino)propoxycarbonyloxy]-13-hydroxytridecyl] 9-pentyltetradecanoate (PubChem CID 118168932) has the molecular formula C38H75NO6 and a molecular weight of 642.02 g/mol. Its IUPAC name is [3-[3-(dimethylamino)propoxycarbonyloxy]-13-hydroxytridecyl] 9-pentyltetradecanoate.
| Compound Name | [3-[3-(dimethylamino)propoxycarbonyloxy]-13-hydroxytridecyl] 9-pentyltetradecanoate |
|---|---|
| PubChem CID | 118168932 |
| Molecular Formula | C38H75NO6 |
| Molecular Weight | 642.02 g/mol |
| Exact Mass | 641.56 |
| IUPAC Name | [3-[3-(dimethylamino)propoxycarbonyloxy]-13-hydroxytridecyl] 9-pentyltetradecanoate |
| SMILES | CCCCCC(CCCCC)CCCCCCCC(=O)OCCC(CCCCCCCCCCO)OC(=O)OCCCN(C)C |
| InChI | InChI=1S/C38H75NO6/c1-5-7-18-25-35(26-19-8-6-2)27-20-14-13-16-22-29-37(41)43-34-30-36(45-38(42)44-33-24-31-39(3)4)28-21-15-11-9-10-12-17-23-32-40/h35-36,40H,5-34H2,1-4H3 |
| InChIKey | RADOHBOGNVADQA-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.02 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|