C47H90NO4P — CID 123958639
5-butylnon-2-enyl 8-[[8-(5-butylnon-2-enoxy)-8-oxooctyl]-[3-(dimethylamino)propyl]phosphanyl]octanoate (PubChem CID 123958639) has the molecular formula C47H90NO4P and a molecular weight of 764.21 g/mol. Its IUPAC name is 5-butylnon-2-enyl 8-[[8-(5-butylnon-2-enoxy)-8-oxooctyl]-[3-(dimethylamino)propyl]phosphanyl]octanoate.
| Compound Name | 5-butylnon-2-enyl 8-[[8-(5-butylnon-2-enoxy)-8-oxooctyl]-[3-(dimethylamino)propyl]phosphanyl]octanoate |
|---|---|
| PubChem CID | 123958639 |
| Molecular Formula | C47H90NO4P |
| Molecular Weight | 764.21 g/mol |
| Exact Mass | 763.66 |
| IUPAC Name | 5-butylnon-2-enyl 8-[[8-(5-butylnon-2-enoxy)-8-oxooctyl]-[3-(dimethylamino)propyl]phosphanyl]octanoate |
| SMILES | CCCCC(CC=CCOC(=O)CCCCCCCP(CCCCCCCC(=O)OCC=CCC(CCCC)CCCC)CCCN(C)C)CCCC |
| InChI | InChI=1S/C47H90NO4P/c1-7-11-30-44(31-12-8-2)34-23-25-39-51-46(49)36-21-17-15-19-27-41-53(43-29-38-48(5)6)42-28-20-16-18-22-37-47(50)52-40-26-24-35-45(32-13-9-3)33-14-10-4/h23-26,44-45H,7-22,27-43H2,1-6H3 |
| InChIKey | QSLXJNSHJJEDLA-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.21 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|