C50H90NO5P — CID 123668218
3-(4-propylcyclohexyl)prop-2-enyl 10-[4-(dimethylamino)butanoyl-[10-oxo-10-[3-(4-propylcyclohexyl)prop-2-enoxy]decyl]phosphanyl]decanoate (PubChem CID 123668218) has the molecular formula C50H90NO5P and a molecular weight of 816.25 g/mol. Its IUPAC name is 3-(4-propylcyclohexyl)prop-2-enyl 10-[4-(dimethylamino)butanoyl-[10-oxo-10-[3-(4-propylcyclohexyl)prop-2-enoxy]decyl]phosphanyl]decanoate.
| Compound Name | 3-(4-propylcyclohexyl)prop-2-enyl 10-[4-(dimethylamino)butanoyl-[10-oxo-10-[3-(4-propylcyclohexyl)prop-2-enoxy]decyl]phosphanyl]decanoate |
|---|---|
| PubChem CID | 123668218 |
| Molecular Formula | C50H90NO5P |
| Molecular Weight | 816.25 g/mol |
| Exact Mass | 815.66 |
| IUPAC Name | 3-(4-propylcyclohexyl)prop-2-enyl 10-[4-(dimethylamino)butanoyl-[10-oxo-10-[3-(4-propylcyclohexyl)prop-2-enoxy]decyl]phosphanyl]decanoate |
| SMILES | CCCC1CCC(C=CCOC(=O)CCCCCCCCCP(CCCCCCCCCC(=O)OCC=CC2CCC(CCC)CC2)C(=O)CCCN(C)C)CC1 |
| InChI | InChI=1S/C50H90NO5P/c1-5-24-44-31-35-46(36-32-44)26-22-40-55-48(52)28-17-13-9-7-11-15-19-42-57(50(54)30-21-39-51(3)4)43-20-16-12-8-10-14-18-29-49(53)56-41-23-27-47-37-33-45(25-6-2)34-38-47/h22-23,26-27,44-47H,5-21,24-25,28-43H2,1-4H3 |
| InChIKey | KRJASIGBDDOTRR-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.25 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|