C48H92N2O3S — CID 118330012
3-hexyldecyl 8-[2-(dimethylamino)propylsulfanylcarbonyl-[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate (PubChem CID 118330012) has the molecular formula C48H92N2O3S and a molecular weight of 777.34 g/mol. Its IUPAC name is 3-hexyldecyl 8-[2-(dimethylamino)propylsulfanylcarbonyl-[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate.
| Compound Name | 3-hexyldecyl 8-[2-(dimethylamino)propylsulfanylcarbonyl-[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate |
|---|---|
| PubChem CID | 118330012 |
| Molecular Formula | C48H92N2O3S |
| Molecular Weight | 777.34 g/mol |
| Exact Mass | 776.68 |
| IUPAC Name | 3-hexyldecyl 8-[2-(dimethylamino)propylsulfanylcarbonyl-[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCN(CCCCCCCC(=O)OCCC(CCCCCC)CCCCCCC)C(=O)SCC(C)N(C)C |
| InChI | InChI=1S/C48H92N2O3S/c1-7-10-13-16-17-18-19-20-21-22-23-24-25-26-30-35-41-50(48(52)54-44-45(4)49(5)6)42-36-31-27-29-34-39-47(51)53-43-40-46(37-32-15-12-9-3)38-33-28-14-11-8-2/h18-19,21-22,45-46H,7-17,20,23-44H2,1-6H3/b19-18-,22-21- |
| InChIKey | QYYQJLPRONXGOK-VYEFPUSRSA-N |
| XLogP | 15.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.34 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|