About 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate
2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate (PubChem CID 118330023) has the molecular formula C40H80N2O3S
and a molecular weight of 669.16 g/mol. Its IUPAC name is 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate.
Molecular Properties
| Compound Name | 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate |
| PubChem CID | 118330023 |
| Molecular Formula | C40H80N2O3S |
| Molecular Weight | 669.16 g/mol |
| Exact Mass | 668.59 |
| IUPAC Name | 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate |
| SMILES | CCCCCCCCCCN(CCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)C(=O)SCC(C)N(C)C |
| InChI | InChI=1S/C40H80N2O3S/c1-7-10-13-16-18-19-23-28-33-42(40(44)46-36-37(4)41(5)6)34-29-24-20-22-27-32-39(43)45-35-38(30-25-15-12-9-3)31-26-21-17-14-11-8-2/h37-38H,7-36H2,1-6H3 |
| InChIKey | NUFSCABIUKCGRR-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 669.16 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate?
The IUPAC name of 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate (CID 118330023) is 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate.
What is the SMILES notation for 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate?
The canonical SMILES for 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate is CCCCCCCCCCN(CCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)C(=O)SCC(C)N(C)C.
What is the InChIKey of 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate?
The InChIKey is NUFSCABIUKCGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H80N2O3S/c1-7-10-13-16-18-19-23-28-33-42(40(44)46-36-37(4)41(5)6)34-29-24-20-22-27-32-39(43)45-35-38(30-25-15-12-9-3)31-26-21-17-14-11-8-2/h37-38H,7-36H2,1-6H3.
What are the key properties of 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate?
2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate has a molecular weight of 669.16 g/mol, XLogP of 12.45, 34 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyldecyl 8-[decyl-[2-(dimethylamino)propylsulfanylcarbonyl]amino]octanoate is sourced from PubChem (CID 118330023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).