C59H116N2O7 — CID 176847394
ditridecan-7-yl 10-[4-butoxybutyl-[3-(dimethylamino)propyl]carbamoyl]oxynonadecanedioate (PubChem CID 176847394) has the molecular formula C59H116N2O7 and a molecular weight of 965.58 g/mol. Its IUPAC name is ditridecan-7-yl 10-[4-butoxybutyl-[3-(dimethylamino)propyl]carbamoyl]oxynonadecanedioate.
| Compound Name | ditridecan-7-yl 10-[4-butoxybutyl-[3-(dimethylamino)propyl]carbamoyl]oxynonadecanedioate |
|---|---|
| PubChem CID | 176847394 |
| Molecular Formula | C59H116N2O7 |
| Molecular Weight | 965.58 g/mol |
| Exact Mass | 964.88 |
| IUPAC Name | ditridecan-7-yl 10-[4-butoxybutyl-[3-(dimethylamino)propyl]carbamoyl]oxynonadecanedioate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCCCCC(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)OC(=O)N(CCCCOCCCC)CCCN(C)C |
| InChI | InChI=1S/C59H116N2O7/c1-8-13-18-30-41-54(42-31-19-14-9-2)66-57(62)47-36-28-24-22-26-34-45-56(68-59(64)61(51-40-49-60(6)7)50-38-39-53-65-52-17-12-5)46-35-27-23-25-29-37-48-58(63)67-55(43-32-20-15-10-3)44-33-21-16-11-4/h54-56H,8-53H2,1-7H3 |
| InChIKey | PYKSPPAEPRFDGF-UHFFFAOYSA-N |
| XLogP | 17.29 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.58 |
| LogP ≤ 5 | 17.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|