C60H118N2O7 — CID 176847272
ditridecan-7-yl 10-[3-(dimethylamino)propyl-(7-hydroxynonyl)carbamoyl]oxynonadecanedioate (PubChem CID 176847272) has the molecular formula C60H118N2O7 and a molecular weight of 979.61 g/mol. Its IUPAC name is ditridecan-7-yl 10-[3-(dimethylamino)propyl-(7-hydroxynonyl)carbamoyl]oxynonadecanedioate.
| Compound Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-(7-hydroxynonyl)carbamoyl]oxynonadecanedioate |
|---|---|
| PubChem CID | 176847272 |
| Molecular Formula | C60H118N2O7 |
| Molecular Weight | 979.61 g/mol |
| Exact Mass | 978.89 |
| IUPAC Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-(7-hydroxynonyl)carbamoyl]oxynonadecanedioate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCCCCC(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)OC(=O)N(CCCCCCC(O)CC)CCCN(C)C |
| InChI | InChI=1S/C60H118N2O7/c1-8-13-17-32-43-55(44-33-18-14-9-2)67-58(64)49-38-27-23-21-25-36-47-57(69-60(66)62(53-41-51-61(6)7)52-40-30-29-31-42-54(63)12-5)48-37-26-22-24-28-39-50-59(65)68-56(45-34-19-15-10-3)46-35-20-16-11-4/h54-57,63H,8-53H2,1-7H3 |
| InChIKey | NIVFMZLHECGJJZ-UHFFFAOYSA-N |
| XLogP | 17.41 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.61 |
| LogP ≤ 5 | 17.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|