C58H114N2O7 — CID 176847334
ditridecan-7-yl 10-[3-(dimethylamino)propyl-(4-hydroxyheptyl)carbamoyl]oxynonadecanedioate (PubChem CID 176847334) has the molecular formula C58H114N2O7 and a molecular weight of 951.56 g/mol. Its IUPAC name is ditridecan-7-yl 10-[3-(dimethylamino)propyl-(4-hydroxyheptyl)carbamoyl]oxynonadecanedioate.
| Compound Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-(4-hydroxyheptyl)carbamoyl]oxynonadecanedioate |
|---|---|
| PubChem CID | 176847334 |
| Molecular Formula | C58H114N2O7 |
| Molecular Weight | 951.56 g/mol |
| Exact Mass | 950.86 |
| IUPAC Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-(4-hydroxyheptyl)carbamoyl]oxynonadecanedioate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCCCCC(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)OC(=O)N(CCCC(O)CCC)CCCN(C)C |
| InChI | InChI=1S/C58H114N2O7/c1-8-13-17-29-41-53(42-30-18-14-9-2)65-56(62)47-35-27-23-21-25-33-45-55(67-58(64)60(51-38-49-59(6)7)50-37-40-52(61)39-12-5)46-34-26-22-24-28-36-48-57(63)66-54(43-31-19-15-10-3)44-32-20-16-11-4/h52-55,61H,8-51H2,1-7H3 |
| InChIKey | XKRPIDJBFUDRBM-UHFFFAOYSA-N |
| XLogP | 16.63 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.56 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|