C41H75NO2 — CID 166796347
[(6Z,16Z)-12-[(Z)-undec-5-en-2-yl]docosa-6,16,21-trien-11-yl] 6-(dimethylamino)hexanoate (PubChem CID 166796347) has the molecular formula C41H75NO2 and a molecular weight of 614.06 g/mol. Its IUPAC name is [(6Z,16Z)-12-[(Z)-undec-5-en-2-yl]docosa-6,16,21-trien-11-yl] 6-(dimethylamino)hexanoate.
| Compound Name | [(6Z,16Z)-12-[(Z)-undec-5-en-2-yl]docosa-6,16,21-trien-11-yl] 6-(dimethylamino)hexanoate |
|---|---|
| PubChem CID | 166796347 |
| Molecular Formula | C41H75NO2 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 613.58 |
| IUPAC Name | [(6Z,16Z)-12-[(Z)-undec-5-en-2-yl]docosa-6,16,21-trien-11-yl] 6-(dimethylamino)hexanoate |
| SMILES | C=CCCC/C=C\CCCC(C(C)CC/C=C\CCCCC)C(CCC/C=C\CCCCC)OC(=O)CCCCCN(C)C |
| InChI | InChI=1S/C41H75NO2/c1-7-10-13-16-19-22-25-29-34-39(38(4)33-28-24-21-18-15-12-9-3)40(35-30-26-23-20-17-14-11-8-2)44-41(43)36-31-27-32-37-42(5)6/h7,19-24,38-40H,1,8-18,25-37H2,2-6H3/b22-19-,23-20-,24-21- |
| InChIKey | GRWPKRGWIYXTHZ-BUTYCLJRSA-N |
| XLogP | 12.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|