C34H65NO4 — CID 169320643
2-[6-(dimethylamino)hexanoyloxy]oct-7-enyl 2-heptylundecanoate (PubChem CID 169320643) has the molecular formula C34H65NO4 and a molecular weight of 551.90 g/mol. Its IUPAC name is 2-[6-(dimethylamino)hexanoyloxy]oct-7-enyl 2-heptylundecanoate.
| Compound Name | 2-[6-(dimethylamino)hexanoyloxy]oct-7-enyl 2-heptylundecanoate |
|---|---|
| PubChem CID | 169320643 |
| Molecular Formula | C34H65NO4 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.49 |
| IUPAC Name | 2-[6-(dimethylamino)hexanoyloxy]oct-7-enyl 2-heptylundecanoate |
| SMILES | C=CCCCCC(COC(=O)C(CCCCCCC)CCCCCCCCC)OC(=O)CCCCCN(C)C |
| InChI | InChI=1S/C34H65NO4/c1-6-9-12-15-16-18-21-26-31(25-20-17-13-10-7-2)34(37)38-30-32(27-22-14-11-8-3)39-33(36)28-23-19-24-29-35(4)5/h8,31-32H,3,6-7,9-30H2,1-2,4-5H3 |
| InChIKey | NVYGVIGGNZFSQL-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|