About 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate
2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate (PubChem CID 170054159) has the molecular formula C28H55NO4
and a molecular weight of 469.75 g/mol. Its IUPAC name is 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate.
Molecular Properties
| Compound Name | 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate |
| PubChem CID | 170054159 |
| Molecular Formula | C28H55NO4 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.41 |
| IUPAC Name | 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)OCC(C)OC(=O)CCCCN(C)C |
| InChI | InChI=1S/C28H55NO4/c1-6-8-10-12-13-15-17-21-26(20-16-14-11-9-7-2)28(31)32-24-25(3)33-27(30)22-18-19-23-29(4)5/h25-26H,6-24H2,1-5H3 |
| InChIKey | SULWIWZMHMTVPW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate?
The IUPAC name of 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate (CID 170054159) is 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate.
What is the SMILES notation for 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate?
The canonical SMILES for 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate is CCCCCCCCCC(CCCCCCC)C(=O)OCC(C)OC(=O)CCCCN(C)C.
What is the InChIKey of 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate?
The InChIKey is SULWIWZMHMTVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H55NO4/c1-6-8-10-12-13-15-17-21-26(20-16-14-11-9-7-2)28(31)32-24-25(3)33-27(30)22-18-19-23-29(4)5/h25-26H,6-24H2,1-5H3.
What are the key properties of 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate?
2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate has a molecular weight of 469.75 g/mol, XLogP of 7.31, 23 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(dimethylamino)pentanoyloxy]propyl 2-heptylundecanoate is sourced from PubChem (CID 170054159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).