C43H82N2O4 — CID 176591813
[1,4-bis(methylamino)-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-nonadec-10-enoate (PubChem CID 176591813) has the molecular formula C43H82N2O4 and a molecular weight of 691.14 g/mol. Its IUPAC name is [1,4-bis(methylamino)-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-nonadec-10-enoate.
| Compound Name | [1,4-bis(methylamino)-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-nonadec-10-enoate |
|---|---|
| PubChem CID | 176591813 |
| Molecular Formula | C43H82N2O4 |
| Molecular Weight | 691.14 g/mol |
| Exact Mass | 690.63 |
| IUPAC Name | [1,4-bis(methylamino)-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-nonadec-10-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(=O)OC(CNC)C(CNC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H82N2O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(47)49-41(39-45-4)40(38-44-3)48-42(46)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,40-41,44-45H,5-18,23-39H2,1-4H3/b21-19-,22-20- |
| InChIKey | MZFXMIPXIIXNSB-WRBBJXAJSA-N |
| XLogP | 11.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.14 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|