C31H52O5 — CID 173067282
1,3-dihydroxypropan-2-yl 13-hept-1-enyl-14-oxohenicosa-5,8,11-trienoate (PubChem CID 173067282) has the molecular formula C31H52O5 and a molecular weight of 504.75 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 13-hept-1-enyl-14-oxohenicosa-5,8,11-trienoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 13-hept-1-enyl-14-oxohenicosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 173067282 |
| Molecular Formula | C31H52O5 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 13-hept-1-enyl-14-oxohenicosa-5,8,11-trienoate |
| SMILES | CCCCCC=CC(C=CCC=CCC=CCCCC(=O)OC(CO)CO)C(=O)CCCCCCC |
| InChI | InChI=1S/C31H52O5/c1-3-5-7-14-18-22-28(30(34)24-20-15-8-6-4-2)23-19-16-12-10-9-11-13-17-21-25-31(35)36-29(26-32)27-33/h10-13,18-19,22-23,28-29,32-33H,3-9,14-17,20-21,24-27H2,1-2H3 |
| InChIKey | XRGXYFTYQOANQI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|