C47H80O5 — CID 134726829
[(2S)-1-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate (PubChem CID 134726829) has the molecular formula C47H80O5 and a molecular weight of 725.15 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-1-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134726829 |
| Molecular Formula | C47H80O5 |
| Molecular Weight | 725.15 g/mol |
| Exact Mass | 724.60 |
| IUPAC Name | [(2S)-1-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C47H80O5/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-26-28-30-32-34-36-38-40-42-47(50)52-45(43-48)44-51-46(49)41-39-37-35-33-31-29-27-25-20-18-16-14-12-10-8-6-4-2/h12,14,18-21,23-24,28,30,34,36,45,48H,3-11,13,15-17,22,25-27,29,31-33,35,37-44H2,1-2H3/b14-12+,20-18+,21-19+,24-23+,30-28+,36-34+/t45-/m0/s1 |
| InChIKey | DISAMUHSKOVWDV-FZDFPQSSSA-N |
| XLogP | 13.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.15 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|